Products 2758-49-8

CAS 2758-49-8 is the registry number for 2-(4-Chloro-5-methoxy-2-methylphenoxy)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-(4-chloro-5-methoxy-2-methylphenoxy)acetic acid (CAS 2758-49-8) is a chemical compound with the molecular formula C10H11ClO4 and a molecular weight of 230.64 g/mol. IUPAC name: 2-(4-chloro-5-methoxy-2-methylphenoxy)acetic acid. InChIKey: UZJJPXWYMDNPAY-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11ClO4
Molecular weight230.64 g/mol
IUPAC name2-(4-chloro-5-methoxy-2-methylphenoxy)acetic acid
InChIKeyUZJJPXWYMDNPAY-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1OCC(=O)O)OC)Cl

Computed by PubChem (NCBI)