CAS 69922-28-7 appears in our catalog under these names: 3,4-(METHYLENEDIOXY)PHENYL ISOCYANATE, &, 5-isocyanato-1,3-benzodioxole, 95%. Offered by: Sigma-Aldrich, Fluorochem. Available pack sizes: 5G, 1g.
5-isocyanato-1,3-benzodioxole (CAS 69922-28-7) is a chemical compound with the molecular formula C8H5NO3 and a molecular weight of 163.13 g/mol. IUPAC name: 5-isocyanato-1,3-benzodioxole. InChIKey: GTTXYMVUACJZRG-UHFFFAOYSA-N.
| Molecular formula | C8H5NO3 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | 5-isocyanato-1,3-benzodioxole |
| InChIKey | GTTXYMVUACJZRG-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)N=C=O |
Computed by PubChem (NCBI)