CAS 69227-65-2 appears in our catalog under these names: 4-Nitro-1-benzofuran, 97%, 4-Nitrobenzofuran, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 25g, 10g.
4-nitro-1-benzofuran (CAS 69227-65-2) is a chemical compound with the molecular formula C8H5NO3 and a molecular weight of 163.13 g/mol. IUPAC name: 4-nitro-1-benzofuran. InChIKey: HOPJVUYLPKTWEF-UHFFFAOYSA-N.
| Molecular formula | C8H5NO3 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | 4-nitro-1-benzofuran |
| InChIKey | HOPJVUYLPKTWEF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C=COC2=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)