CAS 116569-07-4 appears in our catalog under these names: 7-Hydroxyisatin, 95%, 7-Hydroxyindoline-2,3-dione, 95+%, 7-Hydroxyindoline-2,3-dione, >95%, >95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg.
7-hydroxy-1H-indole-2,3-dione (CAS 116569-07-4) is a chemical compound with the molecular formula C8H5NO3 and a molecular weight of 163.13 g/mol. IUPAC name: 7-hydroxy-1H-indole-2,3-dione. InChIKey: LZRMULBVRCNCPX-UHFFFAOYSA-N.
| Molecular formula | C8H5NO3 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | 7-hydroxy-1H-indole-2,3-dione |
| InChIKey | LZRMULBVRCNCPX-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)O)NC(=O)C2=O |
Computed by PubChem (NCBI)