CAS 642-91-1 appears in our catalog under these names: 2,1-Benzisoxazole-3-carboxylic acid, 96%, 2,1-benzisoxazole-3-carboxylic acid, 2,1-benzoxazole-3-carboxylic acid, 95%, 95%, Benzo[c]isoxazole-3-carboxylic acid, 96%, Benzo[c]isoxazole-3-carboxylic acid, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 25g, 10g, 5g, 250mg, 100mg.
2,1-benzoxazole-3-carboxylic acid (CAS 642-91-1) is a chemical compound with the molecular formula C8H5NO3 and a molecular weight of 163.13 g/mol. IUPAC name: 2,1-benzoxazole-3-carboxylic acid. InChIKey: PHYDLUSJJFZNFG-UHFFFAOYSA-N.
| Molecular formula | C8H5NO3 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | 2,1-benzoxazole-3-carboxylic acid |
| InChIKey | PHYDLUSJJFZNFG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(ON=C2C=C1)C(=O)O |
Computed by PubChem (NCBI)