Products 17395-99-2
CAS 17395-99-2 appears in our catalog under these names: 4-Amino-2-benzofuran-1,3-dione, 98%, 4-Aminoisobenzofuran-1,3-dione, 95%, 4–Aminoisobenzofuran–1，3–dione, 4-Aminoisobenzofuran-1,3-dione 95%, 4-Aminoisobenzofuran-1,3-dione, 95%, 95%. Offered by: Fluorochem, Combi-blocks, GLPBio, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-amino-2-benzofuran-1,3-dione (CAS 17395-99-2) is a chemical compound with the molecular formula C8H5NO3 and a molecular weight of 163.13 g/mol. IUPAC name: 4-amino-2-benzofuran-1,3-dione. InChIKey: DQNFPCOVVBRXOY-UHFFFAOYSA-N.
| Molecular formula | C8H5NO3 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | 4-amino-2-benzofuran-1,3-dione |
| InChIKey | DQNFPCOVVBRXOY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)N)C(=O)OC2=O |
Computed by PubChem (NCBI)