CAS 10435-57-1 appears in our catalog under these names: 5-cyano-2-hydroxybenzoic acid, 95%, 5-Cyano-2-hydroxybenzoic acid, 5-Cyano-2-hydroxybenzoic acid, 95%, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 5g, 1g, 10g, 250mg, 0,5g, 25g.
5-cyano-2-hydroxybenzoic acid (CAS 10435-57-1) is a chemical compound with the molecular formula C8H5NO3 and a molecular weight of 163.13 g/mol. IUPAC name: 5-cyano-2-hydroxybenzoic acid. InChIKey: XUNYRQCTAPBWCF-UHFFFAOYSA-N.
| Molecular formula | C8H5NO3 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | 5-cyano-2-hydroxybenzoic acid |
| InChIKey | XUNYRQCTAPBWCF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C#N)C(=O)O)O |
Computed by PubChem (NCBI)