cas: 1107064-09-4 — see every product listed under this CAS number, including other names
3,4-Dihydro-2h-1,5-benzodioxepin-6-ylboronic acid, 95%, 95% (CAS 1107064-09-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12C6KU-100mg |
| cas | 1107064-09-4 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 208.40 Pln | |
| Chemat | 250mg | 304.40 Pln | |
| Chemat | 1g | 712.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3,4-dihydro-2H-1,5-benzodioxepin-6-ylboronic acid (CAS 1107064-09-4) is a chemical compound with the molecular formula C9H11BO4 and a molecular weight of 193.99 g/mol. IUPAC name: 3,4-dihydro-2H-1,5-benzodioxepin-6-ylboronic acid. InChIKey: BTDVUENZZYXXFN-UHFFFAOYSA-N.
| Molecular formula | C9H11BO4 |
|---|---|
| Molecular weight | 193.99 g/mol |
| IUPAC name | 3,4-dihydro-2H-1,5-benzodioxepin-6-ylboronic acid |
| InChIKey | BTDVUENZZYXXFN-UHFFFAOYSA-N |
| SMILES | B(C1=C2C(=CC=C1)OCCCO2)(O)O |
Computed by PubChem (NCBI)