cas: 402-87-9 — see every product listed under this CAS number, including other names
3,5-DIBROMO-4-FLUOROBENZOIC ACID, 98% (CAS 402-87-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F831885-250MG |
| cas | 402-87-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 445.69 Pln | |
| Fluorochem | 1g | 1080.89 Pln | |
| Fluorochem | 5g | 2658.46 Pln | |
| Fluorochem | 10g | 4006.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3,5-dibromo-4-fluorobenzoic acid (CAS 402-87-9) is a chemical compound with the molecular formula C7H3Br2FO2 and a molecular weight of 297.90 g/mol. IUPAC name: 3,5-dibromo-4-fluorobenzoic acid. InChIKey: URZMIPMWYXHUMI-UHFFFAOYSA-N.
| Molecular formula | C7H3Br2FO2 |
|---|---|
| Molecular weight | 297.90 g/mol |
| IUPAC name | 3,5-dibromo-4-fluorobenzoic acid |
| InChIKey | URZMIPMWYXHUMI-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Br)F)Br)C(=O)O |
Computed by PubChem (NCBI)