cas: 14615-72-6 — see every product listed under this CAS number, including other names
3,5-Dibenzyloxybenzaldehyde, 98%, 98% (CAS 14615-72-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 500g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112DR1-1g |
| cas | 14615-72-6 |
| size | 1g |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 107.60 Pln | |
| Chemat | 25g | 222.80 Pln | |
| Chemat | 100g | 578.00 Pln | |
| Chemat | 500g | 2664.00 Pln | |
| Chemat | 10g | 150.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3,5-bis(phenylmethoxy)benzaldehyde (CAS 14615-72-6) is a chemical compound with the molecular formula C21H18O3 and a molecular weight of 318.4 g/mol. IUPAC name: 3,5-bis(phenylmethoxy)benzaldehyde. InChIKey: CHUAMRVJSRBRHT-UHFFFAOYSA-N.
| Molecular formula | C21H18O3 |
|---|---|
| Molecular weight | 318.4 g/mol |
| IUPAC name | 3,5-bis(phenylmethoxy)benzaldehyde |
| InChIKey | CHUAMRVJSRBRHT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=CC(=C2)C=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)