Products 1391054-77-5

CAS 1391054-77-5 is the registry number for 2-(2,3-Dihydro-7-methoxy-1H-phenalen-1-yl)-benzoic Acid. Offered by: TRC. Available pack sizes: 2,5mg, 25mg.

Structural formula: {0} (CAS {1})

2-(6-methoxy-2,3-dihydro-1H-phenalen-1-yl)benzoic acid (CAS 1391054-77-5) is a chemical compound with the molecular formula C21H18O3 and a molecular weight of 318.4 g/mol. IUPAC name: 2-(6-methoxy-2,3-dihydro-1H-phenalen-1-yl)benzoic acid. InChIKey: LIRQYYRHJLQCOX-UHFFFAOYSA-N.

Identity
Molecular formulaC21H18O3
Molecular weight318.4 g/mol
IUPAC name2-(6-methoxy-2,3-dihydro-1H-phenalen-1-yl)benzoic acid
InChIKeyLIRQYYRHJLQCOX-UHFFFAOYSA-N
SMILESCOC1=C2C=CC=C3C2=C(CCC3C4=CC=CC=C4C(=O)O)C=C1

Computed by PubChem (NCBI)