CAS 1610531-11-7 is the registry number for 5-((1E)-2-(4-Hydroxyphenyl)ethenyl)-2-(phenylmethyl)-1,3-benzenediol. Offered by: TRC. Available pack sizes: 100mg.
2-benzyl-5-[(E)-2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol (CAS 1610531-11-7) is a chemical compound with the molecular formula C21H18O3 and a molecular weight of 318.4 g/mol. IUPAC name: 2-benzyl-5-[(E)-2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol. InChIKey: YJDRBUZHHWCCKI-VOTSOKGWSA-N.
| Molecular formula | C21H18O3 |
|---|---|
| Molecular weight | 318.4 g/mol |
| IUPAC name | 2-benzyl-5-[(E)-2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol |
| InChIKey | YJDRBUZHHWCCKI-VOTSOKGWSA-N |
| SMILES | C1=CC=C(C=C1)CC2=C(C=C(C=C2O)/C=C/C3=CC=C(C=C3)O)O |
Computed by PubChem (NCBI)