cas: 2426639-91-8 — see every product listed under this CAS number, including other names
3,5-Dibromo-2-fluoro-4-hydroxybenzaldehyde, 95%, 95% (CAS 2426639-91-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1312KR-100mg |
| cas | 2426639-91-8 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 438.80 Pln | |
| Chemat | 250mg | 698.00 Pln | |
| Chemat | 1g | 1782.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3,5-dibromo-2-fluoro-4-hydroxybenzaldehyde (CAS 2426639-91-8) is a chemical compound with the molecular formula C7H3Br2FO2 and a molecular weight of 297.90 g/mol. IUPAC name: 3,5-dibromo-2-fluoro-4-hydroxybenzaldehyde. InChIKey: VUVZWDHWJRDZMJ-UHFFFAOYSA-N.
| Molecular formula | C7H3Br2FO2 |
|---|---|
| Molecular weight | 297.90 g/mol |
| IUPAC name | 3,5-dibromo-2-fluoro-4-hydroxybenzaldehyde |
| InChIKey | VUVZWDHWJRDZMJ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)O)Br)F)C=O |
Computed by PubChem (NCBI)