3,5-Dichloro-4-nitropyridine, 97%
cas: 433294-98-5 — see every product listed under this CAS number, including other names
3,5-Dichloro-4-nitropyridine, 97% (CAS 433294-98-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 1g, 250mg, 25g, 100mg. Offered by: Combi-blocks, Fluorochem, Ambeed, BLDpharm.
| brand | Combi-blocks |
|---|---|
| catalog number | QA-9066-5g |
| cas | 433294-98-5 |
| size | 5g |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 10g | price on request | |
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 250mg | price on request | |
| Fluorochem | 10g | 2726.14 Pln | |
| Fluorochem | 25g | 5485.59 Pln | |
| Ambeed | 100mg | 142.31 Pln | |
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 481.62 Pln | |
| Ambeed | 5g | 1460.62 Pln | |
| Ambeed | 10g | 2645.44 Pln | |
| Ambeed | 25g | 5376.62 Pln | |
| Fluorochem | 250mg | 148.92 Pln | |
| Fluorochem | 1g | 398.84 Pln | |
| Fluorochem | 5g | 1513.03 Pln | |
| BLDpharm | 100mg | 147.75 Pln | |
| BLDpharm | 250mg | 186.63 Pln | |
| BLDpharm | 1g | 514.29 Pln | |
| BLDpharm | 5g | 1569.47 Pln | |
| BLDpharm | 10g | 2846.80 Pln | |
| BLDpharm | 25g | 5790.21 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
3,5-dichloro-4-nitropyridine (CAS 433294-98-5) is a chemical compound with the molecular formula C5H2Cl2N2O2 and a molecular weight of 192.98 g/mol. IUPAC name: 3,5-dichloro-4-nitropyridine. InChIKey: JGZHZSXAYXXCFB-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl2N2O2 |
|---|---|
| Molecular weight | 192.98 g/mol |
| IUPAC name | 3,5-dichloro-4-nitropyridine |
| InChIKey | JGZHZSXAYXXCFB-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C=N1)Cl)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)