cas: 22978-61-6 — see every product listed under this CAS number, including other names
3,5-Dichlorobenzimidamide hydrochloride, 95% (CAS 22978-61-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F456856-100MG |
| cas | 22978-61-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 227.02 Pln | |
| Fluorochem | 250mg | 289.50 Pln | |
| Fluorochem | 500mg | 388.42 Pln | |
| Fluorochem | 1g | 404.04 Pln | |
| Fluorochem | 5g | 1106.92 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
3,5-dichlorobenzenecarboximidamide;hydrochloride (CAS 22978-61-6) is a chemical compound with the molecular formula C7H7Cl3N2 and a molecular weight of 225.5 g/mol. IUPAC name: 3,5-dichlorobenzenecarboximidamide;hydrochloride. InChIKey: FFLPJEKRAYZAMU-UHFFFAOYSA-N.
| Molecular formula | C7H7Cl3N2 |
|---|---|
| Molecular weight | 225.5 g/mol |
| IUPAC name | 3,5-dichlorobenzenecarboximidamide;hydrochloride |
| InChIKey | FFLPJEKRAYZAMU-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Cl)C(=N)N.Cl |
Computed by PubChem (NCBI)