cas: 89-35-0 — see every product listed under this CAS number, including other names
3,5-Dihydroxy-2-naphthoic acid, 97% (CAS 89-35-0) is a chemical reagent available from Chemat. Available pack sizes: 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A254902-25g |
| cas | 89-35-0 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 5974.57 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
3,5-dihydroxynaphthalene-2-carboxylic acid (CAS 89-35-0) is a chemical compound with the molecular formula C11H8O4 and a molecular weight of 204.18 g/mol. IUPAC name: 3,5-dihydroxynaphthalene-2-carboxylic acid. InChIKey: YELLAPKUWRTITI-UHFFFAOYSA-N.
| Molecular formula | C11H8O4 |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | 3,5-dihydroxynaphthalene-2-carboxylic acid |
| InChIKey | YELLAPKUWRTITI-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=C(C=C2C(=C1)O)O)C(=O)O |
Computed by PubChem (NCBI)