cas: 89-35-0 — see every product listed under this CAS number, including other names
3,5-Dihydroxy-2-naphthoic acid (CAS 89-35-0) is a chemical reagent available from Chemat. Available pack sizes: 25g, 10g, 50g, 100g, 1mg, 5mg, 10mg, 25mg. Offered by: Biosynth, Chemat.
| brand | Biosynth |
|---|---|
| catalog number | FD76223-25g |
| cas | 89-35-0 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Biosynth | 25g | price on request | |
| Biosynth | 10g | price on request | |
| Biosynth | 50g | price on request | |
| Biosynth | 100g | price on request | |
| Chemat | 1mg | 203.60 Pln | |
| Chemat | 5mg | 342.80 Pln | |
| Chemat | 10mg | 482.00 Pln | |
| Chemat | 25mg | 784.40 Pln | |
| Chemat | 50mg | 1134.80 Pln | |
| Chemat | 100mg | 1686.80 Pln | |
| Chemat | 200mg | 2493.20 Pln | |
| Chemat | 500mg | 4178.00 Pln |
| category | Research Chemicals |
|---|---|
| sub-category 1 | Building Blocks |
| sub-category 2 | Naphthalene Derivatives |
| purity | No data |
| delivery time | 1-2 weeks |
3,5-dihydroxynaphthalene-2-carboxylic acid (CAS 89-35-0) is a chemical compound with the molecular formula C11H8O4 and a molecular weight of 204.18 g/mol. IUPAC name: 3,5-dihydroxynaphthalene-2-carboxylic acid. InChIKey: YELLAPKUWRTITI-UHFFFAOYSA-N.
| Molecular formula | C11H8O4 |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | 3,5-dihydroxynaphthalene-2-carboxylic acid |
| InChIKey | YELLAPKUWRTITI-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=C(C=C2C(=C1)O)O)C(=O)O |
Computed by PubChem (NCBI)