cas: 61226-19-5 — see every product listed under this CAS number, including other names
3,5-Dimethyl-1-phenyl-1 H -pyrazole-4-carboxylic acid (CAS 61226-19-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F028168-1G |
| cas | 61226-19-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 419.66 Pln | |
| Fluorochem | 5g | 1664.02 Pln |
| delivery time | 3-4 weeks |
|---|
3,5-dimethyl-1-phenylpyrazole-4-carboxylic acid (CAS 61226-19-5) is a chemical compound with the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. IUPAC name: 3,5-dimethyl-1-phenylpyrazole-4-carboxylic acid. InChIKey: LPYTYYLNGJGJGW-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O2 |
|---|---|
| Molecular weight | 216.24 g/mol |
| IUPAC name | 3,5-dimethyl-1-phenylpyrazole-4-carboxylic acid |
| InChIKey | LPYTYYLNGJGJGW-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C2=CC=CC=C2)C)C(=O)O |
Computed by PubChem (NCBI)