cas: 1214352-42-7 — see every product listed under this CAS number, including other names
3,6-Dibromo-2-fluorobenzoic acid 95+% (CAS 1214352-42-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A625459-250mg |
| cas | 1214352-42-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 398.19 Pln | |
| Ambeed | 1g | 943.31 Pln | |
| Ambeed | 5g | 3123.81 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A625459 |
3,6-dibromo-2-fluorobenzoic acid (CAS 1214352-42-7) is a chemical compound with the molecular formula C7H3Br2FO2 and a molecular weight of 297.90 g/mol. IUPAC name: 3,6-dibromo-2-fluorobenzoic acid. InChIKey: XUWXFNAXMCSSJT-UHFFFAOYSA-N.
| Molecular formula | C7H3Br2FO2 |
|---|---|
| Molecular weight | 297.90 g/mol |
| IUPAC name | 3,6-dibromo-2-fluorobenzoic acid |
| InChIKey | XUWXFNAXMCSSJT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1Br)C(=O)O)F)Br |
Computed by PubChem (NCBI)