cas: 356783-15-8 — see every product listed under this CAS number, including other names
3,6-Dichloropyrazine-2-carboxylic acid, 95%, 95% (CAS 356783-15-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11D6A3-100mg |
| cas | 356783-15-8 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 189.20 Pln | |
| Chemat | 250mg | 256.40 Pln | |
| Chemat | 1g | 846.80 Pln | |
| Chemat | 5g | 3995.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3,6-dichloropyrazine-2-carboxylic acid (CAS 356783-15-8) is a chemical compound with the molecular formula C5H2Cl2N2O2 and a molecular weight of 192.98 g/mol. IUPAC name: 3,6-dichloropyrazine-2-carboxylic acid. InChIKey: JKDYBIZSSBHQLV-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl2N2O2 |
|---|---|
| Molecular weight | 192.98 g/mol |
| IUPAC name | 3,6-dichloropyrazine-2-carboxylic acid |
| InChIKey | JKDYBIZSSBHQLV-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(C(=N1)Cl)C(=O)O)Cl |
Computed by PubChem (NCBI)