cas: 108238-41-1 — see every product listed under this CAS number, including other names
3,6-Dihydroxyflavone 98% (CAS 108238-41-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A975493-100mg |
| cas | 108238-41-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 270.25 Pln | |
| Ambeed | 250mg | 309.19 Pln | |
| Ambeed | 1g | 709.69 Pln | |
| Ambeed | 5g | 2105.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A975493 |
3,6-dihydroxy-2-phenylchromen-4-one (CAS 108238-41-1) is a chemical compound with the molecular formula C15H10O4 and a molecular weight of 254.24 g/mol. IUPAC name: 3,6-dihydroxy-2-phenylchromen-4-one. InChIKey: XHLOLFKZCUCROE-UHFFFAOYSA-N.
| Molecular formula | C15H10O4 |
|---|---|
| Molecular weight | 254.24 g/mol |
| IUPAC name | 3,6-dihydroxy-2-phenylchromen-4-one |
| InChIKey | XHLOLFKZCUCROE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C(=O)C3=C(O2)C=CC(=C3)O)O |
Computed by PubChem (NCBI)