cas: 43015-44-7 — see every product listed under this CAS number, including other names
3,6-Dimethyl-2,5-pyrazinedicarboxylic acid (CAS 43015-44-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JWJ7-100mg |
| cas | 43015-44-7 |
| size | 100mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 477.20 Pln | |
| Chemat | 250mg | 774.80 Pln | |
| Chemat | 1g | 1989.20 Pln |
| delivery time | 3 weeks |
|---|
3,6-dimethylpyrazine-2,5-dicarboxylic acid (CAS 43015-44-7) is a chemical compound with the molecular formula C8H8N2O4 and a molecular weight of 196.16 g/mol. IUPAC name: 3,6-dimethylpyrazine-2,5-dicarboxylic acid. InChIKey: FTVHHZKDJQVMCP-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O4 |
|---|---|
| Molecular weight | 196.16 g/mol |
| IUPAC name | 3,6-dimethylpyrazine-2,5-dicarboxylic acid |
| InChIKey | FTVHHZKDJQVMCP-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(C(=N1)C(=O)O)C)C(=O)O |
Computed by PubChem (NCBI)