Products 3558-19-8
CAS 3558-19-8 appears in our catalog under these names: Methyl 2-amino-4-nitrobenzoate, 98%, Methyl 2-amino-4-nitrobenzoate 98%, Methyl 2-amino-4-nitrobenzoate, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 25g, 250mg, 100mg.
Methyl 2-amino-4-nitrobenzoate (CAS 3558-19-8) is a chemical compound with the molecular formula C8H8N2O4 and a molecular weight of 196.16 g/mol. IUPAC name: methyl 2-amino-4-nitrobenzoate. InChIKey: VGURYVWLCVIMTF-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O4 |
|---|---|
| Molecular weight | 196.16 g/mol |
| IUPAC name | methyl 2-amino-4-nitrobenzoate |
| InChIKey | VGURYVWLCVIMTF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)[N+](=O)[O-])N |
Computed by PubChem (NCBI)
Synonyms:
methyl 4-nitroanthranilate, Methyl 2-amino-4-nitrobenzoate, 2-amino-4-nitrobenzoic acid methyl ester, Benzoic acid, 2-amino-4-nitro-, methyl ester, 2-Amino-4-nitro-benzoic acid methyl ester, Anthranilic acid, 4-nitro-, methyl ester, methyl 2-amino-4-nitro-benzoate, Azilsartan impurity 145, Methyl2-amino-4-nitrobenzoate, 4-nitroanthranilic acid methyl ester