CAS 4116-35-2 appears in our catalog under these names: 1,3-Dimethyl-1,5-dihydrofuro[3,4-d]pyrimidine-2,4,7(3h)-trione, 95%, 1,3-Dimethylfuro(3,4-d)pyrimidine-2,4,7(1H,3H,5H)-trione, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
1,3-dimethyl-5H-furo[3,4-d]pyrimidine-2,4,7-trione (CAS 4116-35-2) is a chemical compound with the molecular formula C8H8N2O4 and a molecular weight of 196.16 g/mol. IUPAC name: 1,3-dimethyl-5H-furo[3,4-d]pyrimidine-2,4,7-trione. InChIKey: UCIQSCIRXXCLTG-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O4 |
|---|---|
| Molecular weight | 196.16 g/mol |
| IUPAC name | 1,3-dimethyl-5H-furo[3,4-d]pyrimidine-2,4,7-trione |
| InChIKey | UCIQSCIRXXCLTG-UHFFFAOYSA-N |
| SMILES | CN1C2=C(COC2=O)C(=O)N(C1=O)C |
Computed by PubChem (NCBI)