Products 604000-34-2

CAS 604000-34-2 is the registry number for 6-(Ethoxycarbonyl)pyridazine-3-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 250mg, 5g.

Structural formula: {0} (CAS {1})

6-ethoxycarbonylpyridazine-3-carboxylic acid (CAS 604000-34-2) is a chemical compound with the molecular formula C8H8N2O4 and a molecular weight of 196.16 g/mol. IUPAC name: 6-ethoxycarbonylpyridazine-3-carboxylic acid. InChIKey: IAKGODNDDOWLEN-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8N2O4
Molecular weight196.16 g/mol
IUPAC name6-ethoxycarbonylpyridazine-3-carboxylic acid
InChIKeyIAKGODNDDOWLEN-UHFFFAOYSA-N
SMILESCCOC(=O)C1=NN=C(C=C1)C(=O)O

Computed by PubChem (NCBI)