CAS 30563-98-5 appears in our catalog under these names: Ethyl 5-nitropicolinate, 98%, 98%, Ethyl 5-nitropicolinate, 95%, Ethyl 5-nitropicolinate, 97%. Offered by: Chemat, Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg, 25g, 10g.
Ethyl 5-nitropyridine-2-carboxylate (CAS 30563-98-5) is a chemical compound with the molecular formula C8H8N2O4 and a molecular weight of 196.16 g/mol. IUPAC name: ethyl 5-nitropyridine-2-carboxylate. InChIKey: PZFHVUFNOKRFEC-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O4 |
|---|---|
| Molecular weight | 196.16 g/mol |
| IUPAC name | ethyl 5-nitropyridine-2-carboxylate |
| InChIKey | PZFHVUFNOKRFEC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)