Products 5465-34-9
CAS 5465-34-9 appears in our catalog under these names: 2-Amino-5-methyl-3-nitrobenzoic acid, 95%, 2-Amino-5-methyl-3-nitrobenzoic acid, 95+%, 2-Amino-5-methyl-3-nitrobenzoic acid, 2-Amino-5-methyl-3-nitrobenzoic acid 95+%, 2-Amino-5-methyl-3-nitrobenzoic acid, 95+%, 95+%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
2-amino-5-methyl-3-nitrobenzoic acid (CAS 5465-34-9) is a chemical compound with the molecular formula C8H8N2O4 and a molecular weight of 196.16 g/mol. IUPAC name: 2-amino-5-methyl-3-nitrobenzoic acid. InChIKey: RRUISNJFUYWQKF-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O4 |
|---|---|
| Molecular weight | 196.16 g/mol |
| IUPAC name | 2-amino-5-methyl-3-nitrobenzoic acid |
| InChIKey | RRUISNJFUYWQKF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)[N+](=O)[O-])N)C(=O)O |
Computed by PubChem (NCBI)