cas: 10215-25-5 — see every product listed under this CAS number, including other names
3,6-THIOXANTHENEDIAMINE-10,10-DIOXIDE, 95%, 95% (CAS 10215-25-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1117RH-5g |
| cas | 10215-25-5 |
| size | 5g |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 1374.80 Pln | |
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 203.60 Pln | |
| Chemat | 1g | 414.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
10,10-dioxo-9H-thioxanthene-3,6-diamine (CAS 10215-25-5) is a chemical compound with the molecular formula C13H12N2O2S and a molecular weight of 260.31 g/mol. IUPAC name: 10,10-dioxo-9H-thioxanthene-3,6-diamine. InChIKey: UPVRZVIJGVFROW-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O2S |
|---|---|
| Molecular weight | 260.31 g/mol |
| IUPAC name | 10,10-dioxo-9H-thioxanthene-3,6-diamine |
| InChIKey | UPVRZVIJGVFROW-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=C(C=C2)N)S(=O)(=O)C3=C1C=CC(=C3)N |
Computed by PubChem (NCBI)