cas: 10215-25-5 — see every product listed under this CAS number, including other names
3,6-Thioxanthenediamine-10,10-dioxide, 97% (CAS 10215-25-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 25g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 420910010 |
| cas | 10215-25-5 |
| size | 1g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 1g | 433.86 Pln | |
| Thermo Scientific (Acros) | 10g | 1959.96 Pln | |
| Thermo Scientific (Acros) | 25g | 3977.82 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
10,10-dioxo-9H-thioxanthene-3,6-diamine (CAS 10215-25-5) is a chemical compound with the molecular formula C13H12N2O2S and a molecular weight of 260.31 g/mol. IUPAC name: 10,10-dioxo-9H-thioxanthene-3,6-diamine. InChIKey: UPVRZVIJGVFROW-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O2S |
|---|---|
| Molecular weight | 260.31 g/mol |
| IUPAC name | 10,10-dioxo-9H-thioxanthene-3,6-diamine |
| InChIKey | UPVRZVIJGVFROW-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=C(C=C2)N)S(=O)(=O)C3=C1C=CC(=C3)N |
Computed by PubChem (NCBI)