cas: 10215-25-5 — see every product listed under this CAS number, including other names
9H-thioxanthene-3,6-diamine 10,10-dioxide, 97% (CAS 10215-25-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F374652-100MG |
| cas | 10215-25-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 159.34 Pln | |
| Fluorochem | 250mg | 247.85 Pln | |
| Fluorochem | 1g | 513.38 Pln | |
| Fluorochem | 5g | 2257.56 Pln | |
| Fluorochem | 10g | 3673.72 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
10,10-dioxo-9H-thioxanthene-3,6-diamine (CAS 10215-25-5) is a chemical compound with the molecular formula C13H12N2O2S and a molecular weight of 260.31 g/mol. IUPAC name: 10,10-dioxo-9H-thioxanthene-3,6-diamine. InChIKey: UPVRZVIJGVFROW-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O2S |
|---|---|
| Molecular weight | 260.31 g/mol |
| IUPAC name | 10,10-dioxo-9H-thioxanthene-3,6-diamine |
| InChIKey | UPVRZVIJGVFROW-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=C(C=C2)N)S(=O)(=O)C3=C1C=CC(=C3)N |
Computed by PubChem (NCBI)