cas: 188814-36-0 — see every product listed under this CAS number, including other names
3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(4-fluorophenyl)propanoic acid, 97%, 97% (CAS 188814-36-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AOEI-100mg |
| cas | 188814-36-0 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 213.20 Pln | |
| Chemat | 250mg | 256.40 Pln | |
| Chemat | 1g | 501.20 Pln | |
| Chemat | 5g | 1384.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-fluorophenyl)propanoic acid (CAS 188814-36-0) is a chemical compound with the molecular formula C24H20FNO4 and a molecular weight of 405.4 g/mol. IUPAC name: 3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-fluorophenyl)propanoic acid. InChIKey: PQXRHKBSMBRBBW-UHFFFAOYSA-N.
| Molecular formula | C24H20FNO4 |
|---|---|
| Molecular weight | 405.4 g/mol |
| IUPAC name | 3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-fluorophenyl)propanoic acid |
| InChIKey | PQXRHKBSMBRBBW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(CC(=O)O)C4=CC=C(C=C4)F |
Computed by PubChem (NCBI)