CAS 198545-72-1 appears in our catalog under these names: Fmoc–m–fluoro–D–Phe–OH, Fmoc-D-Phe(3-F)-OH, Fmoc-D-Phe(3-F)-OH 98%, Fmoc-D-Phe(3-F)-OH, 98%, 98%, Fmoc-D-Phe(3-F)-OH, 98.80%. Offered by: GLPBio, Iris Biotech, Ambeed, Chemat, MedChemExpress. Available pack sizes: 10g, 25g, 5g, 1g, 5 g, 10 g, 25 g.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-fluorophenyl)propanoic acid (CAS 198545-72-1) is a chemical compound with the molecular formula C24H20FNO4 and a molecular weight of 405.4 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-fluorophenyl)propanoic acid. InChIKey: DWSDVARCJDOADL-JOCHJYFZSA-N.
| Molecular formula | C24H20FNO4 |
|---|---|
| Molecular weight | 405.4 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-fluorophenyl)propanoic acid |
| InChIKey | DWSDVARCJDOADL-JOCHJYFZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CC4=CC(=CC=C4)F)C(=O)O |
Computed by PubChem (NCBI)