cas: 749884-42-2 — see every product listed under this CAS number, including other names
3-((3-chlorophenyl)sulfonamido)benzoic acid (CAS 749884-42-2) is a chemical reagent available from Chemat. Available pack sizes: 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F512256-100G |
| cas | 749884-42-2 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100g | 102.07 Pln | |
| Fluorochem | 500g | 154.13 Pln |
| delivery time | 3-4 weeks |
|---|
3-[(3-chlorophenyl)sulfonylamino]benzoic acid (CAS 749884-42-2) is a chemical compound with the molecular formula C13H10ClNO4S and a molecular weight of 311.74 g/mol. IUPAC name: 3-[(3-chlorophenyl)sulfonylamino]benzoic acid. InChIKey: APBOVLPLJFJSRI-UHFFFAOYSA-N.
| Molecular formula | C13H10ClNO4S |
|---|---|
| Molecular weight | 311.74 g/mol |
| IUPAC name | 3-[(3-chlorophenyl)sulfonylamino]benzoic acid |
| InChIKey | APBOVLPLJFJSRI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)NS(=O)(=O)C2=CC(=CC=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)