CAS 325732-21-6 appears in our catalog under these names: 3-(2-Chloro-phenylsulfamoyl)-benzoic acid, 95%, 3-((2-Chlorophenyl)sulfamoyl)benzoic acid, 95%, 3-((2-Chlorophenyl)sulfamoyl)benzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g, 0,5g.
3-[(2-chlorophenyl)sulfamoyl]benzoic acid (CAS 325732-21-6) is a chemical compound with the molecular formula C13H10ClNO4S and a molecular weight of 311.74 g/mol. IUPAC name: 3-[(2-chlorophenyl)sulfamoyl]benzoic acid. InChIKey: LLFIQYXNGCVXBN-UHFFFAOYSA-N.
| Molecular formula | C13H10ClNO4S |
|---|---|
| Molecular weight | 311.74 g/mol |
| IUPAC name | 3-[(2-chlorophenyl)sulfamoyl]benzoic acid |
| InChIKey | LLFIQYXNGCVXBN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NS(=O)(=O)C2=CC=CC(=C2)C(=O)O)Cl |
Computed by PubChem (NCBI)