Products 380431-08-3
CAS 380431-08-3 appears in our catalog under these names: 4-(2-Chloro-phenylsulfamoyl)-benzoic acid, 95%, 4-((2-Chlorophenyl)sulfamoyl)benzoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
4-[(2-chlorophenyl)sulfamoyl]benzoic acid (CAS 380431-08-3) is a chemical compound with the molecular formula C13H10ClNO4S and a molecular weight of 311.74 g/mol. IUPAC name: 4-[(2-chlorophenyl)sulfamoyl]benzoic acid. InChIKey: IPRDDGKFEQMAKA-UHFFFAOYSA-N.
| Molecular formula | C13H10ClNO4S |
|---|---|
| Molecular weight | 311.74 g/mol |
| IUPAC name | 4-[(2-chlorophenyl)sulfamoyl]benzoic acid |
| InChIKey | IPRDDGKFEQMAKA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NS(=O)(=O)C2=CC=C(C=C2)C(=O)O)Cl |
Computed by PubChem (NCBI)