Products 749884-42-2
CAS 749884-42-2 appears in our catalog under these names: 3-(3-Chlorophenylsulfonamido)benzoic acid, 95%, 3-((3-chlorophenyl)sulfonamido)benzoic acid. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 1g, 100g, 500g.
3-[(3-chlorophenyl)sulfonylamino]benzoic acid (CAS 749884-42-2) is a chemical compound with the molecular formula C13H10ClNO4S and a molecular weight of 311.74 g/mol. IUPAC name: 3-[(3-chlorophenyl)sulfonylamino]benzoic acid. InChIKey: APBOVLPLJFJSRI-UHFFFAOYSA-N.
| Molecular formula | C13H10ClNO4S |
|---|---|
| Molecular weight | 311.74 g/mol |
| IUPAC name | 3-[(3-chlorophenyl)sulfonylamino]benzoic acid |
| InChIKey | APBOVLPLJFJSRI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)NS(=O)(=O)C2=CC(=CC=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Amberlite IR 120 Plus, 3-((3-chlorophenyl)sulfonamido)benzoic acid, 3-[(3-chlorophenyl)sulfonylamino]benzoic Acid, 3-{[(3-Chlorophenyl)sulfonyl]amino}benzoic acid, 3-(3-chloro-benzenesulfonylamino)-benzoic acid, 3-(3-chlorophenylsulfonamido)benzoic acid, Amberlite IR 120 hydrogen form, 3-[[(3-chlorophenyl)sulfonyl]amino]Benzoic acid, Amberlite IR120, H resin, amberlite strongly acidic cation exchanger