Products 1179130-12-1

CAS 1179130-12-1 is the registry number for 2-Chloro-5-[(phenylsulfonyl)amino]benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

5-(benzenesulfonamido)-2-chlorobenzoic acid (CAS 1179130-12-1) is a chemical compound with the molecular formula C13H10ClNO4S and a molecular weight of 311.74 g/mol. IUPAC name: 5-(benzenesulfonamido)-2-chlorobenzoic acid. InChIKey: PDBZUOKGPCNEKC-UHFFFAOYSA-N.

Identity
Molecular formulaC13H10ClNO4S
Molecular weight311.74 g/mol
IUPAC name5-(benzenesulfonamido)-2-chlorobenzoic acid
InChIKeyPDBZUOKGPCNEKC-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)S(=O)(=O)NC2=CC(=C(C=C2)Cl)C(=O)O

Computed by PubChem (NCBI)