Products 199181-50-5
CAS 199181-50-5 appears in our catalog under these names: 4-(4-Chloro-phenylsulfamoyl)-benzoic acid, 95%, 4-(N-(4-Chlorophenyl)sulfamoyl)benzoic acid 97%, 4-(N-(4-Chlorophenyl)sulfamoyl)benzoic acid, 97%, 97%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 10g, 5g, 1g, 250mg, 100mg.
4-[(4-chlorophenyl)sulfamoyl]benzoic acid (CAS 199181-50-5) is a chemical compound with the molecular formula C13H10ClNO4S and a molecular weight of 311.74 g/mol. IUPAC name: 4-[(4-chlorophenyl)sulfamoyl]benzoic acid. InChIKey: XCJFUMVQXOEQIJ-UHFFFAOYSA-N.
| Molecular formula | C13H10ClNO4S |
|---|---|
| Molecular weight | 311.74 g/mol |
| IUPAC name | 4-[(4-chlorophenyl)sulfamoyl]benzoic acid |
| InChIKey | XCJFUMVQXOEQIJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)S(=O)(=O)NC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)