cas: 796084-60-1 — see every product listed under this CAS number, including other names
3-((Dimethyl-1,2-oxazol-4-yl)methoxy)naphthalene-2-carboxylic acid, 95% (CAS 796084-60-1) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1027032-10g |
| cas | 796084-60-1 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 16065.07 Pln | |
| AmBeed | 5g | 10733.38 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]naphthalene-2-carboxylic acid (CAS 796084-60-1) is a chemical compound with the molecular formula C17H15NO4 and a molecular weight of 297.30 g/mol. IUPAC name: 3-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]naphthalene-2-carboxylic acid. InChIKey: SQTBGJCIHOCSKY-UHFFFAOYSA-N.
| Molecular formula | C17H15NO4 |
|---|---|
| Molecular weight | 297.30 g/mol |
| IUPAC name | 3-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]naphthalene-2-carboxylic acid |
| InChIKey | SQTBGJCIHOCSKY-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C)COC2=CC3=CC=CC=C3C=C2C(=O)O |
Computed by PubChem (NCBI)