Products 125700-33-6
CAS 125700-33-6 appears in our catalog under these names: Fmoc-gly-oh-15n, 95%, Fmoc-(15N)Gly-OH, Fmoc-Gly-OH-15N, 98% 97atom%15N, Fmoc–Gly–OH–15N, FMOC-GLY-OH-15N, 98 ATOM % 15N. Offered by: Combi-blocks, Creative Peptides, AmBeed, GLPBio, Sigma-Aldrich. Available pack sizes: 250mg, 1g, 100mg, 5g, 10mg, 25mg, 50mg, 50 mg.
2-(9H-fluoren-9-ylmethoxycarbonyl(15N)amino)acetic acid (CAS 125700-33-6) is a chemical compound with the molecular formula C17H15NO4 and a molecular weight of 298.30 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonyl(15N)amino)acetic acid. InChIKey: NDKDFTQNXLHCGO-CPZJZEHKSA-N.
| Molecular formula | C17H15NO4 |
|---|---|
| Molecular weight | 298.30 g/mol |
| IUPAC name | 2-(9H-fluoren-9-ylmethoxycarbonyl(15N)amino)acetic acid |
| InChIKey | NDKDFTQNXLHCGO-CPZJZEHKSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)[15NH]CC(=O)O |
Computed by PubChem (NCBI)