CAS 869478-09-1 appears in our catalog under these names: 8-Acetyl-6-(benzyloxy)-2h-benzo[b][1,4]oxazin-3(4h)-one, 95%, Olodaterol Impurity 5, 8-Acetyl-6-(benzyloxy)-2H-benzo[b][1,4]oxazin-3(4H)-one 97%, 8-Acetyl-6-(benzyloxy)-2H-benzo[b][1,4]oxazin-3(4H)-one, 97%, 97%, 8-Acetyl-6-(benzyloxy)-2H-benzo[b][1,4]oxazin-3(4H)-one. Offered by: Combi-blocks, Chemat Brand, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 10g, 5g, 1g, on request.
8-acetyl-6-phenylmethoxy-4H-1,4-benzoxazin-3-one (CAS 869478-09-1) is a chemical compound with the molecular formula C17H15NO4 and a molecular weight of 297.30 g/mol. IUPAC name: 8-acetyl-6-phenylmethoxy-4H-1,4-benzoxazin-3-one. InChIKey: URTYAHMRXXVHKS-UHFFFAOYSA-N.
| Molecular formula | C17H15NO4 |
|---|---|
| Molecular weight | 297.30 g/mol |
| IUPAC name | 8-acetyl-6-phenylmethoxy-4H-1,4-benzoxazin-3-one |
| InChIKey | URTYAHMRXXVHKS-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C2C(=CC(=C1)OCC3=CC=CC=C3)NC(=O)CO2 |
Computed by PubChem (NCBI)