CAS 924834-92-4 is the registry number for 7-(4-Methylphenyl)-2,5-dioxo-1,2,5,6,7,8-hexahydroquinoline-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
7-(4-methylphenyl)-2,5-dioxo-1,6,7,8-tetrahydroquinoline-3-carboxylic acid (CAS 924834-92-4) is a chemical compound with the molecular formula C17H15NO4 and a molecular weight of 297.30 g/mol. IUPAC name: 7-(4-methylphenyl)-2,5-dioxo-1,6,7,8-tetrahydroquinoline-3-carboxylic acid. InChIKey: NXSIUBVKCPDWHG-UHFFFAOYSA-N.
| Molecular formula | C17H15NO4 |
|---|---|
| Molecular weight | 297.30 g/mol |
| IUPAC name | 7-(4-methylphenyl)-2,5-dioxo-1,6,7,8-tetrahydroquinoline-3-carboxylic acid |
| InChIKey | NXSIUBVKCPDWHG-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2CC3=C(C=C(C(=O)N3)C(=O)O)C(=O)C2 |
Computed by PubChem (NCBI)