CAS 298215-50-6 appears in our catalog under these names: 6,7-Dimethoxy-2-(4-methylphenyl)-4h-3,1-benzoxazin-4-one, 95%, 6,7-Dimethoxy-2-(4-methylphenyl)-4H-3,1-benzoxazin-4-one, 90%, 6,7-dimethoxy-2-(4-methylphenyl)benzo(d)1,3-oxazin-4-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 5000mg.
6,7-dimethoxy-2-(4-methylphenyl)-3,1-benzoxazin-4-one (CAS 298215-50-6) is a chemical compound with the molecular formula C17H15NO4 and a molecular weight of 297.30 g/mol. IUPAC name: 6,7-dimethoxy-2-(4-methylphenyl)-3,1-benzoxazin-4-one. InChIKey: IYMKWYJOCUGHPB-UHFFFAOYSA-N.
| Molecular formula | C17H15NO4 |
|---|---|
| Molecular weight | 297.30 g/mol |
| IUPAC name | 6,7-dimethoxy-2-(4-methylphenyl)-3,1-benzoxazin-4-one |
| InChIKey | IYMKWYJOCUGHPB-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NC3=CC(=C(C=C3C(=O)O2)OC)OC |
Computed by PubChem (NCBI)