CAS 1035229-32-3 appears in our catalog under these names: 8-Acetyl-5-(benzyloxy)-2h-benzo[b][1,4]oxazin-3(4h)-one, 95%, 8–Acetyl–5–(benzyloxy)–2H–benzo(b)(1,4)oxazin–3(4H)–one. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg, 100mg.
8-acetyl-5-phenylmethoxy-4H-1,4-benzoxazin-3-one (CAS 1035229-32-3) is a chemical compound with the molecular formula C17H15NO4 and a molecular weight of 297.30 g/mol. IUPAC name: 8-acetyl-5-phenylmethoxy-4H-1,4-benzoxazin-3-one. InChIKey: DKSBVRUAVDKXSO-UHFFFAOYSA-N.
| Molecular formula | C17H15NO4 |
|---|---|
| Molecular weight | 297.30 g/mol |
| IUPAC name | 8-acetyl-5-phenylmethoxy-4H-1,4-benzoxazin-3-one |
| InChIKey | DKSBVRUAVDKXSO-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C2C(=C(C=C1)OCC3=CC=CC=C3)NC(=O)CO2 |
Computed by PubChem (NCBI)