3-((Dimethylamino)methyl)-4-fluorobenzoic acid, 95%
cas: 1344076-62-5 — see every product listed under this CAS number, including other names
3-((Dimethylamino)methyl)-4-fluorobenzoic acid, 95% (CAS 1344076-62-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 50mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1085114-100mg |
| cas | 1344076-62-5 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 960.00 Pln | |
| Ambeed | 250mg | 1577.44 Pln | |
| Ambeed | 1g | 4141.75 Pln | |
| Chemat | 50mg | 688.40 Pln | |
| Chemat | 100mg | 1125.20 Pln | |
| Chemat | 250mg | 1864.40 Pln | |
| Chemat | 1g | 4931.60 Pln | |
| BLDpharm | 50mg | 636.47 Pln | |
| BLDpharm | 100mg | 1030.77 Pln | |
| BLDpharm | 250mg | 1697.20 Pln | |
| BLDpharm | 1g | 4457.34 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
3-[(dimethylamino)methyl]-4-fluorobenzoic acid (CAS 1344076-62-5) is a chemical compound with the molecular formula C10H12FNO2 and a molecular weight of 197.21 g/mol. IUPAC name: 3-[(dimethylamino)methyl]-4-fluorobenzoic acid. InChIKey: KHVPFKGFPVPONL-UHFFFAOYSA-N.
| Molecular formula | C10H12FNO2 |
|---|---|
| Molecular weight | 197.21 g/mol |
| IUPAC name | 3-[(dimethylamino)methyl]-4-fluorobenzoic acid |
| InChIKey | KHVPFKGFPVPONL-UHFFFAOYSA-N |
| SMILES | CN(C)CC1=C(C=CC(=C1)C(=O)O)F |
Computed by PubChem (NCBI)
![3-[(dimethylamino)methyl]-4-fluorobenzoic acid, 95%](https://cdn.chemat.com.pl/products/images/2dc8104c5641c1732a9fdbdd6870dc08668121e73cc022a4f5cf842a21e0eb4f.svg)