Products 1538668-95-9
CAS 1538668-95-9 is the registry number for 2-fluoro-4-hydroxy-N-(propan-2-yl)benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-fluoro-4-hydroxy-N-propan-2-ylbenzamide (CAS 1538668-95-9) is a chemical compound with the molecular formula C10H12FNO2 and a molecular weight of 197.21 g/mol. IUPAC name: 2-fluoro-4-hydroxy-N-propan-2-ylbenzamide. InChIKey: UFYDFUCKSHLABV-UHFFFAOYSA-N.
| Molecular formula | C10H12FNO2 |
|---|---|
| Molecular weight | 197.21 g/mol |
| IUPAC name | 2-fluoro-4-hydroxy-N-propan-2-ylbenzamide |
| InChIKey | UFYDFUCKSHLABV-UHFFFAOYSA-N |
| SMILES | CC(C)NC(=O)C1=C(C=C(C=C1)O)F |
Computed by PubChem (NCBI)