CAS 422568-68-1 appears in our catalog under these names: H–4–fluoro–α–Me–D–Phe–OH, Alpha-methyl-d-4-fluorophenylalanine, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
(2R)-2-amino-3-(4-fluorophenyl)-2-methylpropanoic acid (CAS 422568-68-1) is a chemical compound with the molecular formula C10H12FNO2 and a molecular weight of 197.21 g/mol. IUPAC name: (2R)-2-amino-3-(4-fluorophenyl)-2-methylpropanoic acid. InChIKey: BBRMBENCQBOTHY-SNVBAGLBSA-N.
| Molecular formula | C10H12FNO2 |
|---|---|
| Molecular weight | 197.21 g/mol |
| IUPAC name | (2R)-2-amino-3-(4-fluorophenyl)-2-methylpropanoic acid |
| InChIKey | BBRMBENCQBOTHY-SNVBAGLBSA-N |
| SMILES | C[C@@](CC1=CC=C(C=C1)F)(C(=O)O)N |
Computed by PubChem (NCBI)