CAS 741217-33-4 appears in our catalog under these names: (R)-4-Amino-3-(4-fluorophenyl)butanoic acid, (R)-4-Amino-3-(4-fluorophenyl)butanoic acid, 95%, (R)-4-Amino-3-(4-fluorophenyl)butanoic acid, 95%, 95%. Offered by: Biosynth, Combi-blocks, Fluorochem, Chemat. Available pack sizes: 0,5g, 1g, 5g, 25g, 10g, 250mg.
(3R)-4-amino-3-(4-fluorophenyl)butanoic acid (CAS 741217-33-4) is a chemical compound with the molecular formula C10H12FNO2 and a molecular weight of 197.21 g/mol. IUPAC name: (3R)-4-amino-3-(4-fluorophenyl)butanoic acid. InChIKey: QWHXHLDNSXLAPX-QMMMGPOBSA-N.
| Molecular formula | C10H12FNO2 |
|---|---|
| Molecular weight | 197.21 g/mol |
| IUPAC name | (3R)-4-amino-3-(4-fluorophenyl)butanoic acid |
| InChIKey | QWHXHLDNSXLAPX-QMMMGPOBSA-N |
| SMILES | C1=CC(=CC=C1[C@@H](CC(=O)O)CN)F |
Computed by PubChem (NCBI)