Products 1344076-62-5
CAS 1344076-62-5 appears in our catalog under these names: 3-((Dimethylamino)methyl)-4-fluorobenzoic acid, 3-((Dimethylamino)methyl)-4-fluorobenzoic acid, 95%, 3-[(dimethylamino)methyl]-4-fluorobenzoic acid, 95%. Offered by: Biosynth, Ambeed, Chemat, BLDpharm, Fluorochem. Available pack sizes: 50mg, 0,5g, 100mg, 250mg, 1g.
3-[(dimethylamino)methyl]-4-fluorobenzoic acid (CAS 1344076-62-5) is a chemical compound with the molecular formula C10H12FNO2 and a molecular weight of 197.21 g/mol. IUPAC name: 3-[(dimethylamino)methyl]-4-fluorobenzoic acid. InChIKey: KHVPFKGFPVPONL-UHFFFAOYSA-N.
| Molecular formula | C10H12FNO2 |
|---|---|
| Molecular weight | 197.21 g/mol |
| IUPAC name | 3-[(dimethylamino)methyl]-4-fluorobenzoic acid |
| InChIKey | KHVPFKGFPVPONL-UHFFFAOYSA-N |
| SMILES | CN(C)CC1=C(C=CC(=C1)C(=O)O)F |
Computed by PubChem (NCBI)