CAS 130855-57-1 appears in our catalog under these names: H–4–fluoro–α–Me–Phe–OH, Alpha-methyl-l-4-fluorophenylalanine, 95%, (S)-2-Amino-3-(4-fluorophenyl)-2-methylpropanoic acid, 98+%, (S)-2-Amino-3-(4-fluorophenyl)-2-methylpropanoic acid, 97%, 97%. Offered by: GLPBio, Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg, 10g, 25g.
(2S)-2-amino-3-(4-fluorophenyl)-2-methylpropanoic acid (CAS 130855-57-1) is a chemical compound with the molecular formula C10H12FNO2 and a molecular weight of 197.21 g/mol. IUPAC name: (2S)-2-amino-3-(4-fluorophenyl)-2-methylpropanoic acid. InChIKey: BBRMBENCQBOTHY-JTQLQIEISA-N.
| Molecular formula | C10H12FNO2 |
|---|---|
| Molecular weight | 197.21 g/mol |
| IUPAC name | (2S)-2-amino-3-(4-fluorophenyl)-2-methylpropanoic acid |
| InChIKey | BBRMBENCQBOTHY-JTQLQIEISA-N |
| SMILES | C[C@](CC1=CC=C(C=C1)F)(C(=O)O)N |
Computed by PubChem (NCBI)